About 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile
3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile (PubChem CID 134132914) has the molecular formula C22H16N4
and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
| PubChem CID | 134132914 |
| Molecular Formula | C22H16N4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc2n[nH]c(C3CC3)c2c1-c1ccccc1 |
| InChI | InChI=1S/C22H16N4/c23-13-17-18(14-7-3-1-4-8-14)19-21(16-11-12-16)25-26-22(19)24-20(17)15-9-5-2-6-10-15/h1-10,16H,11-12H2,(H,24,25,26) |
| InChIKey | GCCRJQIBIKESRK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
The IUPAC name of 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile (CID 134132914) is 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
What is the SMILES notation for 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
The canonical SMILES for 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile is N#Cc1c(-c2ccccc2)nc2n[nH]c(C3CC3)c2c1-c1ccccc1.
What is the InChIKey of 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
The InChIKey is GCCRJQIBIKESRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4/c23-13-17-18(14-7-3-1-4-8-14)19-21(16-11-12-16)25-26-22(19)24-20(17)15-9-5-2-6-10-15/h1-10,16H,11-12H2,(H,24,25,26).
What are the key properties of 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile has a molecular weight of 336.40 g/mol, XLogP of 5.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile is sourced from PubChem (CID 134132914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).