C34H32N2O6 — CID 134133277
(2R,3R)-2-(3,4-dihydroxyphenyl)-7-hydroxy-N-[(4-methylphenyl)methyl]-5-[(E)-3-[(4-methylphenyl)methylamino]-3-oxoprop-1-enyl]-2,3-dihydro-1-benzofuran-3-carboxamide (PubChem CID 134133277) has the molecular formula C34H32N2O6 and a molecular weight of 564.64 g/mol. Its IUPAC name is (2R,3R)-2-(3,4-dihydroxyphenyl)-7-hydroxy-N-[(4-methylphenyl)methyl]-5-[(E)-3-[(4-methylphenyl)methylamino]-3-oxoprop-1-enyl]-2,3-dihydro-1-benzofuran-3-carboxamide.
| Compound Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-7-hydroxy-N-[(4-methylphenyl)methyl]-5-[(E)-3-[(4-methylphenyl)methylamino]-3-oxoprop-1-enyl]-2,3-dihydro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 134133277 |
| Molecular Formula | C34H32N2O6 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-7-hydroxy-N-[(4-methylphenyl)methyl]-5-[(E)-3-[(4-methylphenyl)methylamino]-3-oxoprop-1-enyl]-2,3-dihydro-1-benzofuran-3-carboxamide |
| SMILES | Cc1ccc(CNC(=O)/C=C/c2cc(O)c3c(c2)[C@@H](C(=O)NCc2ccc(C)cc2)[C@H](c2ccc(O)c(O)c2)O3)cc1 |
| InChI | InChI=1S/C34H32N2O6/c1-20-3-7-22(8-4-20)18-35-30(40)14-11-24-15-26-31(34(41)36-19-23-9-5-21(2)6-10-23)32(42-33(26)29(39)16-24)25-12-13-27(37)28(38)17-25/h3-17,31-32,37-39H,18-19H2,1-2H3,(H,35,40)(H,36,41)/b14-11+/t31-,32+/m1/s1 |
| InChIKey | QCLITYKXEVWRFX-RBUPXXSZSA-N |
| XLogP | 5.28 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|