C17H19Cl2N5O3S — CID 134133376
2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-4-(2-cyanopyrrol-1-yl)-N,N-dimethylbutanamide (PubChem CID 134133376) has the molecular formula C17H19Cl2N5O3S and a molecular weight of 444.34 g/mol. Its IUPAC name is 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-4-(2-cyanopyrrol-1-yl)-N,N-dimethylbutanamide.
| Compound Name | 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-4-(2-cyanopyrrol-1-yl)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 134133376 |
| Molecular Formula | C17H19Cl2N5O3S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-4-(2-cyanopyrrol-1-yl)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)C(CCn1cccc1C#N)NS(=O)(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C17H19Cl2N5O3S/c1-23(2)17(25)15(5-7-24-6-3-4-11(24)10-20)22-28(26,27)12-8-13(18)16(21)14(19)9-12/h3-4,6,8-9,15,22H,5,7,21H2,1-2H3 |
| InChIKey | MDDOBWSLPUGYEP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|