C26H25N5O5 — CID 134133455
ethyl 4-[[4-(3,5-dimethoxyanilino)quinazolin-8-yl]carbamoylamino]benzoate (PubChem CID 134133455) has the molecular formula C26H25N5O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is ethyl 4-[[4-(3,5-dimethoxyanilino)quinazolin-8-yl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[4-(3,5-dimethoxyanilino)quinazolin-8-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 134133455 |
| Molecular Formula | C26H25N5O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | ethyl 4-[[4-(3,5-dimethoxyanilino)quinazolin-8-yl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2cccc3c(Nc4cc(OC)cc(OC)c4)ncnc23)cc1 |
| InChI | InChI=1S/C26H25N5O5/c1-4-36-25(32)16-8-10-17(11-9-16)30-26(33)31-22-7-5-6-21-23(22)27-15-28-24(21)29-18-12-19(34-2)14-20(13-18)35-3/h5-15H,4H2,1-3H3,(H,27,28,29)(H2,30,31,33) |
| InChIKey | RQXPBUNLPZYRPU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |