C14H20O5 — CID 134133459
(1S,2R,3E,7S,11Z,13S,14R)-2,13-dihydroxy-7-methyl-6,15-dioxabicyclo[12.1.0]pentadeca-3,11-dien-5-one (PubChem CID 134133459) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1S,2R,3E,7S,11Z,13S,14R)-2,13-dihydroxy-7-methyl-6,15-dioxabicyclo[12.1.0]pentadeca-3,11-dien-5-one.
| Compound Name | (1S,2R,3E,7S,11Z,13S,14R)-2,13-dihydroxy-7-methyl-6,15-dioxabicyclo[12.1.0]pentadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 134133459 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1S,2R,3E,7S,11Z,13S,14R)-2,13-dihydroxy-7-methyl-6,15-dioxabicyclo[12.1.0]pentadeca-3,11-dien-5-one |
| SMILES | C[C@H]1CCC/C=C\[C@H](O)[C@H]2O[C@H]2[C@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C14H20O5/c1-9-5-3-2-4-6-10(15)13-14(19-13)11(16)7-8-12(17)18-9/h4,6-11,13-16H,2-3,5H2,1H3/b6-4-,8-7+/t9-,10-,11+,13+,14-/m0/s1 |
| InChIKey | IZTMFEJNMBMWKQ-KEYCFLQLSA-N |
| XLogP | 0.70 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|