C23H27O10P — CID 134133497
[5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxochromen-7-yl] dipropan-2-yl phosphate (PubChem CID 134133497) has the molecular formula C23H27O10P and a molecular weight of 494.43 g/mol. Its IUPAC name is [5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxochromen-7-yl] dipropan-2-yl phosphate.
| Compound Name | [5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxochromen-7-yl] dipropan-2-yl phosphate |
|---|---|
| PubChem CID | 134133497 |
| Molecular Formula | C23H27O10P |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxochromen-7-yl] dipropan-2-yl phosphate |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(OP(=O)(OC(C)C)OC(C)C)cc3o2)cc(OC)c1O |
| InChI | InChI=1S/C23H27O10P/c1-12(2)31-34(27,32-13(3)4)33-15-9-16(24)22-17(25)11-18(30-19(22)10-15)14-7-20(28-5)23(26)21(8-14)29-6/h7-13,24,26H,1-6H3 |
| InChIKey | SQCSMLHITFXVBP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|