C33H44O9 — CID 134133620
[(1S,2R,4R,6S,7S,8R,9R,12R)-9-[(2R)-2,3-dimethylbutanoyl]oxy-2,4,12-trihydroxy-2,6,14,14-tetramethyl-10-methylidene-3,13-dioxo-7-tricyclo[10.3.0.04,8]pentadecanyl] benzoate (PubChem CID 134133620) has the molecular formula C33H44O9 and a molecular weight of 584.71 g/mol. Its IUPAC name is [(1S,2R,4R,6S,7S,8R,9R,12R)-9-[(2R)-2,3-dimethylbutanoyl]oxy-2,4,12-trihydroxy-2,6,14,14-tetramethyl-10-methylidene-3,13-dioxo-7-tricyclo[10.3.0.04,8]pentadecanyl] benzoate.
| Compound Name | [(1S,2R,4R,6S,7S,8R,9R,12R)-9-[(2R)-2,3-dimethylbutanoyl]oxy-2,4,12-trihydroxy-2,6,14,14-tetramethyl-10-methylidene-3,13-dioxo-7-tricyclo[10.3.0.04,8]pentadecanyl] benzoate |
|---|---|
| PubChem CID | 134133620 |
| Molecular Formula | C33H44O9 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | [(1S,2R,4R,6S,7S,8R,9R,12R)-9-[(2R)-2,3-dimethylbutanoyl]oxy-2,4,12-trihydroxy-2,6,14,14-tetramethyl-10-methylidene-3,13-dioxo-7-tricyclo[10.3.0.04,8]pentadecanyl] benzoate |
| SMILES | C=C1C[C@]2(O)C(=O)C(C)(C)C[C@H]2[C@@](C)(O)C(=O)[C@@]2(O)C[C@H](C)[C@H](OC(=O)c3ccccc3)[C@@H]2[C@H]1OC(=O)[C@H](C)C(C)C |
| InChI | InChI=1S/C33H44O9/c1-17(2)20(5)26(34)41-24-18(3)14-32(39)22(16-30(6,7)28(32)36)31(8,38)29(37)33(40)15-19(4)25(23(24)33)42-27(35)21-12-10-9-11-13-21/h9-13,17,19-20,22-25,38-40H,3,14-16H2,1-2,4-8H3/t19-,20+,22-,23-,24-,25-,31+,32+,33+/m0/s1 |
| InChIKey | NNZABYXOEHGKLT-XMIPCNIVSA-N |
| XLogP | 3.43 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|