C15H21NO7 — CID 134133626
(2S)-2-[(2,4,6-trimethoxyphenyl)methylamino]pentanedioic acid (PubChem CID 134133626) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is (2S)-2-[(2,4,6-trimethoxyphenyl)methylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(2,4,6-trimethoxyphenyl)methylamino]pentanedioic acid |
|---|---|
| PubChem CID | 134133626 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2S)-2-[(2,4,6-trimethoxyphenyl)methylamino]pentanedioic acid |
| SMILES | COc1cc(OC)c(CN[C@@H](CCC(=O)O)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C15H21NO7/c1-21-9-6-12(22-2)10(13(7-9)23-3)8-16-11(15(19)20)4-5-14(17)18/h6-7,11,16H,4-5,8H2,1-3H3,(H,17,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | ROIIFEYDGXSDTI-NSHDSACASA-N |
| XLogP | 1.12 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |