About 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one
2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one (PubChem CID 134133653) has the molecular formula C20H16N2O3S
and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one |
| PubChem CID | 134133653 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one |
| SMILES | O=c1nc(N2CCOCC2)oc2c1cc(-c1ccsc1)c1ccccc12 |
| InChI | InChI=1S/C20H16N2O3S/c23-19-17-11-16(13-5-10-26-12-13)14-3-1-2-4-15(14)18(17)25-20(21-19)22-6-8-24-9-7-22/h1-5,10-12H,6-9H2 |
| InChIKey | OAGCLFIDFNGSJU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one?
The IUPAC name of 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one (CID 134133653) is 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one.
What is the SMILES notation for 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one?
The canonical SMILES for 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one is O=c1nc(N2CCOCC2)oc2c1cc(-c1ccsc1)c1ccccc12.
What is the InChIKey of 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one?
The InChIKey is OAGCLFIDFNGSJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O3S/c23-19-17-11-16(13-5-10-26-12-13)14-3-1-2-4-15(14)18(17)25-20(21-19)22-6-8-24-9-7-22/h1-5,10-12H,6-9H2.
What are the key properties of 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one?
2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one has a molecular weight of 364.43 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-6-thiophen-3-ylbenzo[h][1,3]benzoxazin-4-one is sourced from PubChem (CID 134133653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).