C26H20F6N4O4S — CID 134133908
N-[[1-(4-acetylphenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide (PubChem CID 134133908) has the molecular formula C26H20F6N4O4S and a molecular weight of 598.53 g/mol. Its IUPAC name is N-[[1-(4-acetylphenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[[1-(4-acetylphenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134133908 |
| Molecular Formula | C26H20F6N4O4S |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | N-[[1-(4-acetylphenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(-n2cc(CN(c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)S(=O)(=O)c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C26H20F6N4O4S/c1-17(37)18-7-11-21(12-8-18)35-15-20(33-34-35)16-36(41(39,40)23-5-3-2-4-6-23)22-13-9-19(10-14-22)24(38,25(27,28)29)26(30,31)32/h2-15,38H,16H2,1H3 |
| InChIKey | MBFNOHXRDYNCFL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |