About [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate
[4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate (PubChem CID 134133944) has the molecular formula C27H25NO5
and a molecular weight of 443.50 g/mol. Its IUPAC name is [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate.
Molecular Properties
| Compound Name | [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate |
| PubChem CID | 134133944 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate |
| SMILES | CC(C)CNC(=O)c1c(-c2ccc(COC(=O)c3cccc(O)c3)cc2)oc2ccccc12 |
| InChI | InChI=1S/C27H25NO5/c1-17(2)15-28-26(30)24-22-8-3-4-9-23(22)33-25(24)19-12-10-18(11-13-19)16-32-27(31)20-6-5-7-21(29)14-20/h3-14,17,29H,15-16H2,1-2H3,(H,28,30) |
| InChIKey | ZBVOCVDHJOZWSY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate?
The IUPAC name of [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate (CID 134133944) is [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate.
What is the SMILES notation for [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate?
The canonical SMILES for [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate is CC(C)CNC(=O)c1c(-c2ccc(COC(=O)c3cccc(O)c3)cc2)oc2ccccc12.
What is the InChIKey of [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate?
The InChIKey is ZBVOCVDHJOZWSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO5/c1-17(2)15-28-26(30)24-22-8-3-4-9-23(22)33-25(24)19-12-10-18(11-13-19)16-32-27(31)20-6-5-7-21(29)14-20/h3-14,17,29H,15-16H2,1-2H3,(H,28,30).
What are the key properties of [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate?
[4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate has a molecular weight of 443.50 g/mol, XLogP of 5.55, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(2-methylpropylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3-hydroxybenzoate is sourced from PubChem (CID 134133944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).