C9H12N2O5 — CID 134133966
(2S)-2-amino-3-[(5R)-3-[(E)-2-carboxyethenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanoic acid (PubChem CID 134133966) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is (2S)-2-amino-3-[(5R)-3-[(E)-2-carboxyethenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[(5R)-3-[(E)-2-carboxyethenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 134133966 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (2S)-2-amino-3-[(5R)-3-[(E)-2-carboxyethenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanoic acid |
| SMILES | N[C@@H](C[C@@H]1CC(/C=C/C(=O)O)=NO1)C(=O)O |
| InChI | InChI=1S/C9H12N2O5/c10-7(9(14)15)4-6-3-5(11-16-6)1-2-8(12)13/h1-2,6-7H,3-4,10H2,(H,12,13)(H,14,15)/b2-1+/t6-,7-/m0/s1 |
| InChIKey | BJDBKCDRBWDQIU-DZZRMOGLSA-N |
| XLogP | -0.43 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|