C29H34F3NO3 — CID 134133990
(1R,4aS,10aR)-6-[N-methoxy-C-[2-(trifluoromethyl)phenyl]carbonimidoyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 134133990) has the molecular formula C29H34F3NO3 and a molecular weight of 501.59 g/mol. Its IUPAC name is (1R,4aS,10aR)-6-[N-methoxy-C-[2-(trifluoromethyl)phenyl]carbonimidoyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-6-[N-methoxy-C-[2-(trifluoromethyl)phenyl]carbonimidoyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 134133990 |
| Molecular Formula | C29H34F3NO3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (1R,4aS,10aR)-6-[N-methoxy-C-[2-(trifluoromethyl)phenyl]carbonimidoyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CON=C(c1cc2c(cc1C(C)C)CC[C@H]1[C@](C)(C(=O)O)CCC[C@]21C)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H34F3NO3/c1-17(2)20-15-18-11-12-24-27(3,13-8-14-28(24,4)26(34)35)23(18)16-21(20)25(33-36-5)19-9-6-7-10-22(19)29(30,31)32/h6-7,9-10,15-17,24H,8,11-14H2,1-5H3,(H,34,35)/t24-,27-,28-/m1/s1 |
| InChIKey | MSTDNGYEYHZPHV-RYRVMRHHSA-N |
| XLogP | 7.32 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|