C11H11N3O3S — CID 13413406
[(E)-1-(benzenesulfonyl)-1-cyanoprop-1-en-2-yl]urea (PubChem CID 13413406) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is [(E)-1-(benzenesulfonyl)-1-cyanoprop-1-en-2-yl]urea.
| Compound Name | [(E)-1-(benzenesulfonyl)-1-cyanoprop-1-en-2-yl]urea |
|---|---|
| PubChem CID | 13413406 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | [(E)-1-(benzenesulfonyl)-1-cyanoprop-1-en-2-yl]urea |
| SMILES | C/C(NC(N)=O)=C(/C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11N3O3S/c1-8(14-11(13)15)10(7-12)18(16,17)9-5-3-2-4-6-9/h2-6H,1H3,(H3,13,14,15)/b10-8+ |
| InChIKey | YOWXYMNQBSQLKQ-CSKARUKUSA-N |
| XLogP | 0.88 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|