C16H18BrNO3 — CID 134134061
(3S,6'R)-4-bromo-1-methyl-6'-propylspiro[indole-3,2'-oxane]-2,4'-dione (PubChem CID 134134061) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is (3S,6'R)-4-bromo-1-methyl-6'-propylspiro[indole-3,2'-oxane]-2,4'-dione.
| Compound Name | (3S,6'R)-4-bromo-1-methyl-6'-propylspiro[indole-3,2'-oxane]-2,4'-dione |
|---|---|
| PubChem CID | 134134061 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (3S,6'R)-4-bromo-1-methyl-6'-propylspiro[indole-3,2'-oxane]-2,4'-dione |
| SMILES | CCC[C@@H]1CC(=O)C[C@@]2(O1)C(=O)N(C)c1cccc(Br)c12 |
| InChI | InChI=1S/C16H18BrNO3/c1-3-5-11-8-10(19)9-16(21-11)14-12(17)6-4-7-13(14)18(2)15(16)20/h4,6-7,11H,3,5,8-9H2,1-2H3/t11-,16+/m1/s1 |
| InChIKey | BDTWMVDSGXDQBF-BZNIZROVSA-N |
| XLogP | 3.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |