C44H43Cl3N6 — CID 134134153
N,N'-bis[[9-[(3-chlorophenyl)methyl]-1-methylpyrido[3,4-b]indol-3-yl]methyl]butane-1,4-diamine;hydrochloride (PubChem CID 134134153) has the molecular formula C44H43Cl3N6 and a molecular weight of 762.23 g/mol. Its IUPAC name is N,N'-bis[[9-[(3-chlorophenyl)methyl]-1-methylpyrido[3,4-b]indol-3-yl]methyl]butane-1,4-diamine;hydrochloride.
| Compound Name | N,N'-bis[[9-[(3-chlorophenyl)methyl]-1-methylpyrido[3,4-b]indol-3-yl]methyl]butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 134134153 |
| Molecular Formula | C44H43Cl3N6 |
| Molecular Weight | 762.23 g/mol |
| Exact Mass | 760.26 |
| IUPAC Name | N,N'-bis[[9-[(3-chlorophenyl)methyl]-1-methylpyrido[3,4-b]indol-3-yl]methyl]butane-1,4-diamine;hydrochloride |
| SMILES | Cc1nc(CNCCCCNCc2cc3c4ccccc4n(Cc4cccc(Cl)c4)c3c(C)n2)cc2c3ccccc3n(Cc3cccc(Cl)c3)c12.Cl |
| InChI | InChI=1S/C44H42Cl2N6.ClH/c1-29-43-39(37-15-3-5-17-41(37)51(43)27-31-11-9-13-33(45)21-31)23-35(49-29)25-47-19-7-8-20-48-26-36-24-40-38-16-4-6-18-42(38)52(44(40)30(2)50-36)28-32-12-10-14-34(46)22-32;/h3-6,9-18,21-24,47-48H,7-8,19-20,25-28H2,1-2H3;1H |
| InChIKey | MPLQDSBNQBAVNH-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.23 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|