About 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole
4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole (PubChem CID 134134263) has the molecular formula C28H17Cl2N5O
and a molecular weight of 510.38 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole |
| PubChem CID | 134134263 |
| Molecular Formula | C28H17Cl2N5O |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole |
| SMILES | Clc1ccc(-c2nc(-c3ccc(-n4cc(-c5cccnc5)nn4)cc3)oc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H17Cl2N5O/c29-22-9-3-18(4-10-22)26-27(19-5-11-23(30)12-6-19)36-28(32-26)20-7-13-24(14-8-20)35-17-25(33-34-35)21-2-1-15-31-16-21/h1-17H |
| InChIKey | QGWVWAMTGICOJI-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole?
The IUPAC name of 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole (CID 134134263) is 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole.
What is the SMILES notation for 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole?
The canonical SMILES for 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole is Clc1ccc(-c2nc(-c3ccc(-n4cc(-c5cccnc5)nn4)cc3)oc2-c2ccc(Cl)cc2)cc1.
What is the InChIKey of 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole?
The InChIKey is QGWVWAMTGICOJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H17Cl2N5O/c29-22-9-3-18(4-10-22)26-27(19-5-11-23(30)12-6-19)36-28(32-26)20-7-13-24(14-8-20)35-17-25(33-34-35)21-2-1-15-31-16-21/h1-17H.
What are the key properties of 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole?
4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole has a molecular weight of 510.38 g/mol, XLogP of 7.63, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(4-chlorophenyl)-2-[4-(4-pyridin-3-yltriazol-1-yl)phenyl]-1,3-oxazole is sourced from PubChem (CID 134134263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).