C14H19ClN2 — CID 134134314
10-chloro-5,5-dimethyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoline (PubChem CID 134134314) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 10-chloro-5,5-dimethyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoline.
| Compound Name | 10-chloro-5,5-dimethyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoline |
|---|---|
| PubChem CID | 134134314 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 10-chloro-5,5-dimethyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoline |
| SMILES | CC1(C)Cc2cccc(Cl)c2N2CCNCC21 |
| InChI | InChI=1S/C14H19ClN2/c1-14(2)8-10-4-3-5-11(15)13(10)17-7-6-16-9-12(14)17/h3-5,12,16H,6-9H2,1-2H3 |
| InChIKey | ONAWUUDVLOPFDC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |