C30H36N2O3 — CID 134134371
3-[(3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-methoxyphenyl)pyrazole-4-carbaldehyde (PubChem CID 134134371) has the molecular formula C30H36N2O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is 3-[(3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-methoxyphenyl)pyrazole-4-carbaldehyde.
| Compound Name | 3-[(3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-methoxyphenyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 134134371 |
| Molecular Formula | C30H36N2O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 3-[(3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-methoxyphenyl)pyrazole-4-carbaldehyde |
| SMILES | COc1ccc(-n2cc(C=O)c(C3=CC[C@H]4[C@@H]5CC=C6C[C@@H](O)CC[C@]6(C)[C@H]5CC[C@]34C)n2)cc1 |
| InChI | InChI=1S/C30H36N2O3/c1-29-14-12-22(34)16-20(29)4-9-24-25-10-11-27(30(25,2)15-13-26(24)29)28-19(18-33)17-32(31-28)21-5-7-23(35-3)8-6-21/h4-8,11,17-18,22,24-26,34H,9-10,12-16H2,1-3H3/t22-,24-,25-,26-,29-,30-/m0/s1 |
| InChIKey | WXAVKJAZIIYXBN-PWFZLMSFSA-N |
| XLogP | 6.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|