C12H17NO4 — CID 134134419
(3aR,4S,7R,7aS)-2-(3-hydroxypropyl)-7a-methyl-4,5,6,7-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 134134419) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-(3-hydroxypropyl)-7a-methyl-4,5,6,7-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-(3-hydroxypropyl)-7a-methyl-4,5,6,7-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 134134419 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-(3-hydroxypropyl)-7a-methyl-4,5,6,7-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@]12C(=O)N(CCCO)C(=O)[C@H]1[C@@H]1CC[C@H]2O1 |
| InChI | InChI=1S/C12H17NO4/c1-12-8-4-3-7(17-8)9(12)10(15)13(11(12)16)5-2-6-14/h7-9,14H,2-6H2,1H3/t7-,8+,9+,12+/m0/s1 |
| InChIKey | SZMLJCKZYYWAIO-FNOROQBZSA-N |
| XLogP | -0.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|