About 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide
4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide (PubChem CID 134134529) has the molecular formula C17H15BrN2O
and a molecular weight of 343.22 g/mol. Its IUPAC name is 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide.
Molecular Properties
| Compound Name | 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide |
| PubChem CID | 134134529 |
| Molecular Formula | C17H15BrN2O |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide |
| SMILES | COc1cccc2c1C=[N+](c1ccc(C#N)cc1)CC2.[Br-] |
| InChI | InChI=1S/C17H15N2O.BrH/c1-20-17-4-2-3-14-9-10-19(12-16(14)17)15-7-5-13(11-18)6-8-15;/h2-8,12H,9-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | ATDOMVUSGGVRSA-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide?
The IUPAC name of 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide (CID 134134529) is 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide.
What is the SMILES notation for 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide?
The canonical SMILES for 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide is COc1cccc2c1C=[N+](c1ccc(C#N)cc1)CC2.[Br-].
What is the InChIKey of 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide?
The InChIKey is ATDOMVUSGGVRSA-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H15N2O.BrH/c1-20-17-4-2-3-14-9-10-19(12-16(14)17)15-7-5-13(11-18)6-8-15;/h2-8,12H,9-10H2,1H3;1H/q+1;/p-1.
What are the key properties of 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide?
4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide has a molecular weight of 343.22 g/mol, XLogP of -0.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile bromide is sourced from PubChem (CID 134134529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).