About 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide
4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide (PubChem CID 134134648) has the molecular formula C14H13FN2O4
and a molecular weight of 292.27 g/mol. Its IUPAC name is 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide.
Molecular Properties
| Compound Name | 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide |
| PubChem CID | 134134648 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide |
| SMILES | O=C(NNCc1ccc(O)c(O)c1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13FN2O4/c15-10-4-1-8(2-5-10)14(21)17-16-7-9-3-6-11(18)13(20)12(9)19/h1-6,16,18-20H,7H2,(H,17,21) |
| InChIKey | MAXORIDDLUGDJW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide?
The IUPAC name of 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide (CID 134134648) is 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide.
What is the SMILES notation for 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide?
The canonical SMILES for 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide is O=C(NNCc1ccc(O)c(O)c1O)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide?
The InChIKey is MAXORIDDLUGDJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O4/c15-10-4-1-8(2-5-10)14(21)17-16-7-9-3-6-11(18)13(20)12(9)19/h1-6,16,18-20H,7H2,(H,17,21).
What are the key properties of 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide?
4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide has a molecular weight of 292.27 g/mol, XLogP of 1.38, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N'-[(2,3,4-trihydroxyphenyl)methyl]benzohydrazide is sourced from PubChem (CID 134134648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).