C31H29N3S — CID 134134800
(13Z)-6,8-bis(4-methylphenyl)-13-[(4-methylphenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene (PubChem CID 134134800) has the molecular formula C31H29N3S and a molecular weight of 475.66 g/mol. Its IUPAC name is (13Z)-6,8-bis(4-methylphenyl)-13-[(4-methylphenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene.
| Compound Name | (13Z)-6,8-bis(4-methylphenyl)-13-[(4-methylphenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene |
|---|---|
| PubChem CID | 134134800 |
| Molecular Formula | C31H29N3S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (13Z)-6,8-bis(4-methylphenyl)-13-[(4-methylphenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene |
| SMILES | Cc1ccc(/C=C2/CNCC3=C2N=C2SC=C(c4ccc(C)cc4)N2C3c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H29N3S/c1-20-4-10-23(11-5-20)16-26-17-32-18-27-29(26)33-31-34(30(27)25-14-8-22(3)9-15-25)28(19-35-31)24-12-6-21(2)7-13-24/h4-16,19,30,32H,17-18H2,1-3H3/b26-16- |
| InChIKey | VBFXJAXVUROSKC-QQXSKIMKSA-N |
| XLogP | 7.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |