C22H31NO2 — CID 134134844
(3aS,6R,6aS,9aR,9bR)-6-benzyl-1-(2-methoxyethyl)-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one (PubChem CID 134134844) has the molecular formula C22H31NO2 and a molecular weight of 341.49 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,9bR)-6-benzyl-1-(2-methoxyethyl)-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one.
| Compound Name | (3aS,6R,6aS,9aR,9bR)-6-benzyl-1-(2-methoxyethyl)-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one |
|---|---|
| PubChem CID | 134134844 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (3aS,6R,6aS,9aR,9bR)-6-benzyl-1-(2-methoxyethyl)-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one |
| SMILES | COCCN1CC[C@H]2CC(=O)[C@H](Cc3ccccc3)[C@H]3CCC[C@@H]1[C@H]23 |
| InChI | InChI=1S/C22H31NO2/c1-25-13-12-23-11-10-17-15-21(24)19(14-16-6-3-2-4-7-16)18-8-5-9-20(23)22(17)18/h2-4,6-7,17-20,22H,5,8-15H2,1H3/t17-,18+,19+,20+,22+/m0/s1 |
| InChIKey | SWGQUHGWQUPGLK-SXEONFLVSA-N |
| XLogP | 3.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |