About N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine
N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine (PubChem CID 134135021) has the molecular formula C23H18N4
and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine.
Molecular Properties
| Compound Name | N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine |
| PubChem CID | 134135021 |
| Molecular Formula | C23H18N4 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine |
| SMILES | C(=C/c1ccccc1)\C(=N\Nc1nncc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C23H18N4/c1-3-9-18(10-4-1)15-16-22(19-11-5-2-6-12-19)25-27-23-21-14-8-7-13-20(21)17-24-26-23/h1-17H,(H,26,27)/b16-15+,25-22- |
| InChIKey | IUZQUGLOCXBWCX-QCGZKTFGSA-N |
| XLogP | 5.16 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine?
The IUPAC name of N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine (CID 134135021) is N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine.
What is the SMILES notation for N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine?
The canonical SMILES for N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine is C(=C/c1ccccc1)\C(=N\Nc1nncc2ccccc12)c1ccccc1.
What is the InChIKey of N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine?
The InChIKey is IUZQUGLOCXBWCX-QCGZKTFGSA-N. The full InChI is InChI=1S/C23H18N4/c1-3-9-18(10-4-1)15-16-22(19-11-5-2-6-12-19)25-27-23-21-14-8-7-13-20(21)17-24-26-23/h1-17H,(H,26,27)/b16-15+,25-22-.
What are the key properties of N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine?
N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine has a molecular weight of 350.43 g/mol, XLogP of 5.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]phthalazin-1-amine is sourced from PubChem (CID 134135021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).