C25H17BrN2 — CID 134135137
2-(naphthalen-2-ylmethyl)-8-aza-2-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene bromide (PubChem CID 134135137) has the molecular formula C25H17BrN2 and a molecular weight of 425.33 g/mol. Its IUPAC name is 2-(naphthalen-2-ylmethyl)-8-aza-2-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene bromide.
| Compound Name | 2-(naphthalen-2-ylmethyl)-8-aza-2-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene bromide |
|---|---|
| PubChem CID | 134135137 |
| Molecular Formula | C25H17BrN2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-(naphthalen-2-ylmethyl)-8-aza-2-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene bromide |
| SMILES | [Br-].c1ccc2c(c1)-c1nccc3cc[n+](Cc4ccc5ccccc5c4)c-2c13 |
| InChI | InChI=1S/C25H17N2.BrH/c1-2-6-20-15-17(9-10-18(20)5-1)16-27-14-12-19-11-13-26-24-21-7-3-4-8-22(21)25(27)23(19)24;/h1-15H,16H2;1H/q+1;/p-1 |
| InChIKey | FEDZGZJYQDCHMS-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|