About 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide
4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide (PubChem CID 134135147) has the molecular formula C21H11F3N2O5
and a molecular weight of 428.32 g/mol. Its IUPAC name is 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide |
| PubChem CID | 134135147 |
| Molecular Formula | C21H11F3N2O5 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cn1)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C21H11F3N2O5/c22-21(23,24)10-4-5-15(25-8-10)26-20(31)9-6-12-17(14(28)7-9)19(30)16-11(18(12)29)2-1-3-13(16)27/h1-8,27-28H,(H,25,26,31) |
| InChIKey | GKSLPWWVZMCJCK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide?
The IUPAC name of 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide (CID 134135147) is 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide.
What is the SMILES notation for 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide?
The canonical SMILES for 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide is O=C(Nc1ccc(C(F)(F)F)cn1)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.
What is the InChIKey of 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide?
The InChIKey is GKSLPWWVZMCJCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H11F3N2O5/c22-21(23,24)10-4-5-15(25-8-10)26-20(31)9-6-12-17(14(28)7-9)19(30)16-11(18(12)29)2-1-3-13(16)27/h1-8,27-28H,(H,25,26,31).
What are the key properties of 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide?
4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide has a molecular weight of 428.32 g/mol, XLogP of 3.54, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-9,10-dioxo-N-[5-(trifluoromethyl)-2-pyridinyl]anthracene-2-carboxamide is sourced from PubChem (CID 134135147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).