About 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile
3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile (PubChem CID 134135190) has the molecular formula C23H25N7
and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile |
| PubChem CID | 134135190 |
| Molecular Formula | C23H25N7 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile |
| SMILES | Cc1nc(N)nc(N)c1CN1CCN(c2cccc(-c3cccc(C#N)c3)c2)CC1 |
| InChI | InChI=1S/C23H25N7/c1-16-21(22(25)28-23(26)27-16)15-29-8-10-30(11-9-29)20-7-3-6-19(13-20)18-5-2-4-17(12-18)14-24/h2-7,12-13H,8-11,15H2,1H3,(H4,25,26,27,28) |
| InChIKey | KKSNKORHYYLJIP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile?
The IUPAC name of 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile (CID 134135190) is 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile.
What is the SMILES notation for 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile?
The canonical SMILES for 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile is Cc1nc(N)nc(N)c1CN1CCN(c2cccc(-c3cccc(C#N)c3)c2)CC1.
What is the InChIKey of 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile?
The InChIKey is KKSNKORHYYLJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N7/c1-16-21(22(25)28-23(26)27-16)15-29-8-10-30(11-9-29)20-7-3-6-19(13-20)18-5-2-4-17(12-18)14-24/h2-7,12-13H,8-11,15H2,1H3,(H4,25,26,27,28).
What are the key properties of 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile?
3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile has a molecular weight of 399.50 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]piperazin-1-yl]phenyl]benzonitrile is sourced from PubChem (CID 134135190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).