About 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one
3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 134135279) has the molecular formula C15H10N2O3
and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 134135279 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c(-c2ccc3c(c2)OCO3)cnc2ccccn12 |
| InChI | InChI=1S/C15H10N2O3/c18-15-11(8-16-14-3-1-2-6-17(14)15)10-4-5-12-13(7-10)20-9-19-12/h1-8H,9H2 |
| InChIKey | OSHBZXSHEIDNMX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one (CID 134135279) is 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one is O=c1c(-c2ccc3c(c2)OCO3)cnc2ccccn12.
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is OSHBZXSHEIDNMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O3/c18-15-11(8-16-14-3-1-2-6-17(14)15)10-4-5-12-13(7-10)20-9-19-12/h1-8H,9H2.
What are the key properties of 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one?
3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 266.26 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 134135279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).