C29H26N3O4+ — CID 134135305
16-[(1-ethylbenzimidazol-2-yl)methoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 134135305) has the molecular formula C29H26N3O4+ and a molecular weight of 480.54 g/mol. Its IUPAC name is 16-[(1-ethylbenzimidazol-2-yl)methoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 16-[(1-ethylbenzimidazol-2-yl)methoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 134135305 |
| Molecular Formula | C29H26N3O4+ |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 16-[(1-ethylbenzimidazol-2-yl)methoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | CCn1c(COc2c(OC)ccc3cc4[n+](cc23)CCc2cc3c(cc2-4)OCO3)nc2ccccc21 |
| InChI | InChI=1S/C29H26N3O4/c1-3-32-23-7-5-4-6-22(23)30-28(32)16-34-29-21-15-31-11-10-19-13-26-27(36-17-35-26)14-20(19)24(31)12-18(21)8-9-25(29)33-2/h4-9,12-15H,3,10-11,16-17H2,1-2H3/q+1 |
| InChIKey | GFYLLOMDDNFRBJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|