C16H18N2O4 — CID 134135354
3-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide (PubChem CID 134135354) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide.
| Compound Name | 3-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide |
|---|---|
| PubChem CID | 134135354 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide |
| SMILES | O=C(CCc1ccccc1)NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C16H18N2O4/c19-13-8-7-12(15(21)16(13)22)10-17-18-14(20)9-6-11-4-2-1-3-5-11/h1-5,7-8,17,19,21-22H,6,9-10H2,(H,18,20) |
| InChIKey | ATGAHZMIBUNKBZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|