C32H52O9 — CID 134135365
(3E,7E,12R,15E,17R,19S,22R,23S,24R,26S)-9,10,17,19,22,23-hexahydroxy-3,12,16,17,24,26-hexamethyl-14-methylidene-1-oxacyclohexacosa-3,7,15-triene-2,21-dione (PubChem CID 134135365) has the molecular formula C32H52O9 and a molecular weight of 580.76 g/mol. Its IUPAC name is (3E,7E,12R,15E,17R,19S,22R,23S,24R,26S)-9,10,17,19,22,23-hexahydroxy-3,12,16,17,24,26-hexamethyl-14-methylidene-1-oxacyclohexacosa-3,7,15-triene-2,21-dione.
| Compound Name | (3E,7E,12R,15E,17R,19S,22R,23S,24R,26S)-9,10,17,19,22,23-hexahydroxy-3,12,16,17,24,26-hexamethyl-14-methylidene-1-oxacyclohexacosa-3,7,15-triene-2,21-dione |
|---|---|
| PubChem CID | 134135365 |
| Molecular Formula | C32H52O9 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | (3E,7E,12R,15E,17R,19S,22R,23S,24R,26S)-9,10,17,19,22,23-hexahydroxy-3,12,16,17,24,26-hexamethyl-14-methylidene-1-oxacyclohexacosa-3,7,15-triene-2,21-dione |
| SMILES | C=C1/C=C(\C)[C@](C)(O)C[C@H](O)CC(=O)[C@H](O)[C@@H](O)[C@H](C)C[C@H](C)OC(=O)/C(C)=C/CC/C=C/C(O)C(O)C[C@H](C)C1 |
| InChI | InChI=1S/C32H52O9/c1-19-13-20(2)15-27(35)26(34)12-10-8-9-11-21(3)31(39)41-24(6)16-22(4)29(37)30(38)28(36)17-25(33)18-32(7,40)23(5)14-19/h10-12,14,20,22,24-27,29-30,33-35,37-38,40H,1,8-9,13,15-18H2,2-7H3/b12-10+,21-11+,23-14+/t20-,22-,24+,25-,26?,27?,29+,30+,32-/m1/s1 |
| InChIKey | ADLMFYSXCVHXHC-QSMXGIPLSA-N |
| XLogP | 3.06 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|