About (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide
(Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide (PubChem CID 134135396) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide.
Molecular Properties
| Compound Name | (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide |
| PubChem CID | 134135396 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide |
| SMILES | CCNC(=O)/C=C\C(=O)Nc1cccc(-c2n[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C19H18N4O2/c1-2-20-17(24)10-11-18(25)21-14-7-5-6-13(12-14)19-15-8-3-4-9-16(15)22-23-19/h3-12H,2H2,1H3,(H,20,24)(H,21,25)(H,22,23)/b11-10- |
| InChIKey | KNIPZTNCWMXIQG-KHPPLWFESA-N |
| XLogP | 2.86 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide?
The IUPAC name of (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide (CID 134135396) is (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide.
What is the SMILES notation for (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide?
The canonical SMILES for (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide is CCNC(=O)/C=C\C(=O)Nc1cccc(-c2n[nH]c3ccccc23)c1.
What is the InChIKey of (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide?
The InChIKey is KNIPZTNCWMXIQG-KHPPLWFESA-N. The full InChI is InChI=1S/C19H18N4O2/c1-2-20-17(24)10-11-18(25)21-14-7-5-6-13(12-14)19-15-8-3-4-9-16(15)22-23-19/h3-12H,2H2,1H3,(H,20,24)(H,21,25)(H,22,23)/b11-10-.
What are the key properties of (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide?
(Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide has a molecular weight of 334.38 g/mol, XLogP of 2.86, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethyl-N'-[3-(1H-indazol-3-yl)phenyl]but-2-enediamide is sourced from PubChem (CID 134135396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).