C25H20F6N4O3S — CID 134135864
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-methylphenyl)triazol-4-yl]methyl]benzenesulfonamide (PubChem CID 134135864) has the molecular formula C25H20F6N4O3S and a molecular weight of 570.52 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-methylphenyl)triazol-4-yl]methyl]benzenesulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-methylphenyl)triazol-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134135864 |
| Molecular Formula | C25H20F6N4O3S |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-methylphenyl)triazol-4-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(-n2cc(CN(c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)S(=O)(=O)c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C25H20F6N4O3S/c1-17-7-11-20(12-8-17)34-15-19(32-33-34)16-35(39(37,38)22-5-3-2-4-6-22)21-13-9-18(10-14-21)23(36,24(26,27)28)25(29,30)31/h2-15,36H,16H2,1H3 |
| InChIKey | PRKNJLSMVKFJFH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |