C19H27N3O5 — CID 134135884
benzyl N-[(2S)-4-methyl-1-[[(E,2S)-4-nitropent-3-en-2-yl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 134135884) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is benzyl N-[(2S)-4-methyl-1-[[(E,2S)-4-nitropent-3-en-2-yl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-methyl-1-[[(E,2S)-4-nitropent-3-en-2-yl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 134135884 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | benzyl N-[(2S)-4-methyl-1-[[(E,2S)-4-nitropent-3-en-2-yl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | C/C(=C\[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C19H27N3O5/c1-13(2)10-17(18(23)20-14(3)11-15(4)22(25)26)21-19(24)27-12-16-8-6-5-7-9-16/h5-9,11,13-14,17H,10,12H2,1-4H3,(H,20,23)(H,21,24)/b15-11+/t14-,17-/m0/s1 |
| InChIKey | KFYDVJKZUGQPIC-GZHMMJFJSA-N |
| XLogP | 3.01 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|