C30H43NO3 — CID 134136378
(1R,4aS,10aR)-6-(C-cyclohexyl-N-prop-2-enoxycarbonimidoyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 134136378) has the molecular formula C30H43NO3 and a molecular weight of 465.68 g/mol. Its IUPAC name is (1R,4aS,10aR)-6-(C-cyclohexyl-N-prop-2-enoxycarbonimidoyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-6-(C-cyclohexyl-N-prop-2-enoxycarbonimidoyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 134136378 |
| Molecular Formula | C30H43NO3 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | (1R,4aS,10aR)-6-(C-cyclohexyl-N-prop-2-enoxycarbonimidoyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | C=CCON=C(c1cc2c(cc1C(C)C)CC[C@H]1[C@](C)(C(=O)O)CCC[C@]21C)C1CCCCC1 |
| InChI | InChI=1S/C30H43NO3/c1-6-17-34-31-27(21-11-8-7-9-12-21)24-19-25-22(18-23(24)20(2)3)13-14-26-29(25,4)15-10-16-30(26,5)28(32)33/h6,18-21,26H,1,7-17H2,2-5H3,(H,32,33)/t26-,29-,30-/m1/s1 |
| InChIKey | AICJVHIVAAMJOB-KXTWMDTESA-N |
| XLogP | 7.39 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|