C22H26FN5O7S — CID 134136399
propan-2-yl (1R,5R)-3-[6-(2-fluoro-4-methylsulfonylanilino)-5-nitropyrimidin-4-yl]oxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 134136399) has the molecular formula C22H26FN5O7S and a molecular weight of 523.54 g/mol. Its IUPAC name is propan-2-yl (1R,5R)-3-[6-(2-fluoro-4-methylsulfonylanilino)-5-nitropyrimidin-4-yl]oxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | propan-2-yl (1R,5R)-3-[6-(2-fluoro-4-methylsulfonylanilino)-5-nitropyrimidin-4-yl]oxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 134136399 |
| Molecular Formula | C22H26FN5O7S |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | propan-2-yl (1R,5R)-3-[6-(2-fluoro-4-methylsulfonylanilino)-5-nitropyrimidin-4-yl]oxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)OC(=O)N1[C@@H]2CC[C@@H]1CC(Oc1ncnc(Nc3ccc(S(C)(=O)=O)cc3F)c1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C22H26FN5O7S/c1-12(2)34-22(29)27-13-4-5-14(27)9-15(8-13)35-21-19(28(30)31)20(24-11-25-21)26-18-7-6-16(10-17(18)23)36(3,32)33/h6-7,10-15H,4-5,8-9H2,1-3H3,(H,24,25,26)/t13-,14-/m1/s1 |
| InChIKey | OLUGZKGEPJBNFE-ZIAGYGMSSA-N |
| XLogP | 3.59 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|