About [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate
[8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate (PubChem CID 134136464) has the molecular formula C25H17NO7
and a molecular weight of 443.41 g/mol. Its IUPAC name is [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate.
Molecular Properties
| Compound Name | [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate |
| PubChem CID | 134136464 |
| Molecular Formula | C25H17NO7 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C(=O)Nc3ccccc3)cc1C2=O |
| InChI | InChI=1S/C25H17NO7/c1-13(27)32-19-10-6-9-17-21(19)24(30)22-18(23(17)29)11-15(12-20(22)33-14(2)28)25(31)26-16-7-4-3-5-8-16/h3-12H,1-2H3,(H,26,31) |
| InChIKey | BKBCPAPCXOWZED-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate?
The IUPAC name of [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate (CID 134136464) is [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate.
What is the SMILES notation for [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate?
The canonical SMILES for [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate is CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C(=O)Nc3ccccc3)cc1C2=O.
What is the InChIKey of [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate?
The InChIKey is BKBCPAPCXOWZED-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17NO7/c1-13(27)32-19-10-6-9-17-21(19)24(30)22-18(23(17)29)11-15(12-20(22)33-14(2)28)25(31)26-16-7-4-3-5-8-16/h3-12H,1-2H3,(H,26,31).
What are the key properties of [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate?
[8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate has a molecular weight of 443.41 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [8-acetyloxy-9,10-dioxo-6-(phenylcarbamoyl)anthracen-1-yl] acetate is sourced from PubChem (CID 134136464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).