C28H30N2O2 — CID 134136493
(8S,13S,14S,17S)-17-hydroxy-13-methyl-N-(2-methyl-3-pyridinyl)-17-prop-1-ynyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 134136493) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is (8S,13S,14S,17S)-17-hydroxy-13-methyl-N-(2-methyl-3-pyridinyl)-17-prop-1-ynyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,13S,14S,17S)-17-hydroxy-13-methyl-N-(2-methyl-3-pyridinyl)-17-prop-1-ynyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 134136493 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (8S,13S,14S,17S)-17-hydroxy-13-methyl-N-(2-methyl-3-pyridinyl)-17-prop-1-ynyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(C(=O)Nc5cccnc5C)ccc4C3=CC[C@@]21C |
| InChI | InChI=1S/C28H30N2O2/c1-4-13-28(32)15-12-24-23-10-7-19-17-20(26(31)30-25-6-5-16-29-18(25)2)8-9-21(19)22(23)11-14-27(24,28)3/h5-6,8-9,11,16-17,23-24,32H,7,10,12,14-15H2,1-3H3,(H,30,31)/t23-,24+,27+,28+/m1/s1 |
| InChIKey | QZJGYVBMHZKQSK-JGPKDBRGSA-N |
| XLogP | 5.16 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|