C27H40N4O7 — CID 134136572
(6R,15S,18S)-6-methyl-2,5,17-trioxo-6-(3-phenylpropylamino)-8,13-dioxa-1,4,16-triazabicyclo[16.3.0]henicosane-15-carboxylic acid (PubChem CID 134136572) has the molecular formula C27H40N4O7 and a molecular weight of 532.64 g/mol. Its IUPAC name is (6R,15S,18S)-6-methyl-2,5,17-trioxo-6-(3-phenylpropylamino)-8,13-dioxa-1,4,16-triazabicyclo[16.3.0]henicosane-15-carboxylic acid.
| Compound Name | (6R,15S,18S)-6-methyl-2,5,17-trioxo-6-(3-phenylpropylamino)-8,13-dioxa-1,4,16-triazabicyclo[16.3.0]henicosane-15-carboxylic acid |
|---|---|
| PubChem CID | 134136572 |
| Molecular Formula | C27H40N4O7 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | (6R,15S,18S)-6-methyl-2,5,17-trioxo-6-(3-phenylpropylamino)-8,13-dioxa-1,4,16-triazabicyclo[16.3.0]henicosane-15-carboxylic acid |
| SMILES | C[C@@]1(NCCCc2ccccc2)COCCCCOC[C@@H](C(=O)O)NC(=O)[C@@H]2CCCN2C(=O)CNC1=O |
| InChI | InChI=1S/C27H40N4O7/c1-27(29-13-7-11-20-9-3-2-4-10-20)19-38-16-6-5-15-37-18-21(25(34)35)30-24(33)22-12-8-14-31(22)23(32)17-28-26(27)36/h2-4,9-10,21-22,29H,5-8,11-19H2,1H3,(H,28,36)(H,30,33)(H,34,35)/t21-,22-,27+/m0/s1 |
| InChIKey | YDHKTVASVDHLJV-BCQCSXDESA-N |
| XLogP | 0.47 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|