C26H32O4 — CID 134136778
(1S,4S,6R,7S)-7-[(1E,3E,5E,7E)-8-[(2S,6S)-3,6-dimethyl-5-methylidene-2H-pyran-2-yl]nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione (PubChem CID 134136778) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is (1S,4S,6R,7S)-7-[(1E,3E,5E,7E)-8-[(2S,6S)-3,6-dimethyl-5-methylidene-2H-pyran-2-yl]nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione.
| Compound Name | (1S,4S,6R,7S)-7-[(1E,3E,5E,7E)-8-[(2S,6S)-3,6-dimethyl-5-methylidene-2H-pyran-2-yl]nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
|---|---|
| PubChem CID | 134136778 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (1S,4S,6R,7S)-7-[(1E,3E,5E,7E)-8-[(2S,6S)-3,6-dimethyl-5-methylidene-2H-pyran-2-yl]nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
| SMILES | C=C1C=C(C)[C@H](/C(C)=C/C=C/C=C/C=C/[C@]2(C)[C@H]3OC(=O)[C@]2(C)C(=O)[C@@H]3C)O[C@H]1C |
| InChI | InChI=1S/C26H32O4/c1-16(21-18(3)15-17(2)20(5)29-21)13-11-9-8-10-12-14-25(6)23-19(4)22(27)26(25,7)24(28)30-23/h8-15,19-21,23H,2H2,1,3-7H3/b10-8+,11-9+,14-12+,16-13+/t19-,20-,21-,23-,25+,26-/m0/s1 |
| InChIKey | KOLYMIXVPBUCMY-RFYDWFOGSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|