C30H34N4O5 — CID 134136880
1-[2-[[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-11-yl]oxy]ethyl]piperidine-4-carboxylic acid (PubChem CID 134136880) has the molecular formula C30H34N4O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is 1-[2-[[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-11-yl]oxy]ethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-11-yl]oxy]ethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 134136880 |
| Molecular Formula | C30H34N4O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 1-[2-[[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-11-yl]oxy]ethyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(CCOc2ccc3cc2COC/C=C/COCc2cccc(c2)-c2ccnc(n2)N3)CC1 |
| InChI | InChI=1S/C30H34N4O5/c35-29(36)23-9-12-34(13-10-23)14-17-39-28-7-6-26-19-25(28)21-38-16-2-1-15-37-20-22-4-3-5-24(18-22)27-8-11-31-30(32-26)33-27/h1-8,11,18-19,23H,9-10,12-17,20-21H2,(H,35,36)(H,31,32,33)/b2-1+ |
| InChIKey | DZDRGJBVJNAMIH-OWOJBTEDSA-N |
| XLogP | 4.67 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|