C28H40O3 — CID 134136919
[(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] 2-phenylacetate (PubChem CID 134136919) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] 2-phenylacetate.
| Compound Name | [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 134136919 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] 2-phenylacetate |
| SMILES | C/C1=C\C[C@]2(C(C)C)CC[C@@](C)(O2)[C@@H](OC(=O)Cc2ccccc2)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C28H40O3/c1-21(2)28-17-16-23(4)11-9-10-22(3)14-15-25(27(5,31-28)18-19-28)30-26(29)20-24-12-7-6-8-13-24/h6-8,10,12-13,16,21,25H,9,11,14-15,17-20H2,1-5H3/b22-10+,23-16+/t25-,27+,28+/m0/s1 |
| InChIKey | QCWPMFRYVOOFJC-UKTRBUHOSA-N |
| XLogP | 6.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|