About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline (PubChem CID 134137108) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline |
| PubChem CID | 134137108 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline |
| SMILES | CCCc1ccccc1NCC1=NCCN1 |
| InChI | InChI=1S/C13H19N3/c1-2-5-11-6-3-4-7-12(11)16-10-13-14-8-9-15-13/h3-4,6-7,16H,2,5,8-10H2,1H3,(H,14,15) |
| InChIKey | DHKRDPVIPVAAGO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline (CID 134137108) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline is CCCc1ccccc1NCC1=NCCN1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline?
The InChIKey is DHKRDPVIPVAAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-2-5-11-6-3-4-7-12(11)16-10-13-14-8-9-15-13/h3-4,6-7,16H,2,5,8-10H2,1H3,(H,14,15).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline has a molecular weight of 217.32 g/mol, XLogP of 2.05, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-propylaniline is sourced from PubChem (CID 134137108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).