C22H23F2N3O2 — CID 134137114
2-[2-[3-[(3,5-difluorophenyl)methylamino]piperidin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 134137114) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[2-[3-[(3,5-difluorophenyl)methylamino]piperidin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[3-[(3,5-difluorophenyl)methylamino]piperidin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134137114 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[2-[3-[(3,5-difluorophenyl)methylamino]piperidin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCCC(NCc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C22H23F2N3O2/c23-16-10-15(11-17(24)12-16)13-25-18-4-3-7-26(14-18)8-9-27-21(28)19-5-1-2-6-20(19)22(27)29/h1-2,5-6,10-12,18,25H,3-4,7-9,13-14H2 |
| InChIKey | XHFWQFUUEFWIKC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|