C25H29ClN4O — CID 134137225
6-chloro-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-(2,4,6-trimethylphenoxy)pyridin-2-amine (PubChem CID 134137225) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is 6-chloro-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-(2,4,6-trimethylphenoxy)pyridin-2-amine.
| Compound Name | 6-chloro-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-(2,4,6-trimethylphenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 134137225 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 6-chloro-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-(2,4,6-trimethylphenoxy)pyridin-2-amine |
| SMILES | Cc1cc(C)c(Oc2cc(Cl)nc(NC3CCN(Cc4ccncc4)CC3)c2)c(C)c1 |
| InChI | InChI=1S/C25H29ClN4O/c1-17-12-18(2)25(19(3)13-17)31-22-14-23(26)29-24(15-22)28-21-6-10-30(11-7-21)16-20-4-8-27-9-5-20/h4-5,8-9,12-15,21H,6-7,10-11,16H2,1-3H3,(H,28,29) |
| InChIKey | CALZUVKTPDJKNU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|