C27H32N4O2 — CID 134137481
ethyl 3-benzyl-13-(cyclohexylamino)-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate (PubChem CID 134137481) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is ethyl 3-benzyl-13-(cyclohexylamino)-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate.
| Compound Name | ethyl 3-benzyl-13-(cyclohexylamino)-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 134137481 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | ethyl 3-benzyl-13-(cyclohexylamino)-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n1Cc1ccccc1)-c1nc(NC3CCCCC3)ncc1CCC2 |
| InChI | InChI=1S/C27H32N4O2/c1-2-33-26(32)23-16-20-12-9-13-21-17-28-27(29-22-14-7-4-8-15-22)30-24(21)25(20)31(23)18-19-10-5-3-6-11-19/h3,5-6,10-11,16-17,22H,2,4,7-9,12-15,18H2,1H3,(H,28,29,30) |
| InChIKey | YTHSUZDOFVSTHS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |