C22H24N6O4 — CID 134137539
4-N,6-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 134137539) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 4-N,6-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 134137539 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-N,6-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)Nc1nc(Nc2ccc3c(c2)OCCO3)nc(Nc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C22H24N6O4/c1-13(2)23-20-26-21(24-14-3-5-16-18(11-14)31-9-7-29-16)28-22(27-20)25-15-4-6-17-19(12-15)32-10-8-30-17/h3-6,11-13H,7-10H2,1-2H3,(H3,23,24,25,26,27,28) |
| InChIKey | JOPIARUSZDUAQE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |