About 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine
6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine (PubChem CID 13413764) has the molecular formula C6H9ClN4
and a molecular weight of 172.62 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| PubChem CID | 13413764 |
| Molecular Formula | C6H9ClN4 |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1nc(N)cc(Cl)n1 |
| InChI | InChI=1S/C6H9ClN4/c1-11(2)6-9-4(7)3-5(8)10-6/h3H,1-2H3,(H2,8,9,10) |
| InChIKey | NMWKOBZHKWXQFS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The IUPAC name of 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine (CID 13413764) is 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine.
What is the SMILES notation for 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The canonical SMILES for 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine is CN(C)c1nc(N)cc(Cl)n1.
What is the InChIKey of 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The InChIKey is NMWKOBZHKWXQFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN4/c1-11(2)6-9-4(7)3-5(8)10-6/h3H,1-2H3,(H2,8,9,10).
What are the key properties of 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine?
6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine has a molecular weight of 172.62 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-N,2-N-dimethylpyrimidine-2,4-diamine is sourced from PubChem (CID 13413764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).