C14H21N5O2S — CID 13413775
2,4-diamino-N,N-dipropylquinazoline-6-sulfonamide (PubChem CID 13413775) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2,4-diamino-N,N-dipropylquinazoline-6-sulfonamide.
| Compound Name | 2,4-diamino-N,N-dipropylquinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 13413775 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2,4-diamino-N,N-dipropylquinazoline-6-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc2nc(N)nc(N)c2c1 |
| InChI | InChI=1S/C14H21N5O2S/c1-3-7-19(8-4-2)22(20,21)10-5-6-12-11(9-10)13(15)18-14(16)17-12/h5-6,9H,3-4,7-8H2,1-2H3,(H4,15,16,17,18) |
| InChIKey | ONDIFFMSUPVKGY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |